C28H29N5O4 — CID 155331765
1-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl-methylamino]phenyl]cyclopropane-1-carbonitrile (PubChem CID 155331765) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is 1-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl-methylamino]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl-methylamino]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 155331765 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 1-[4-[4-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]butyl-methylamino]phenyl]cyclopropane-1-carbonitrile |
| SMILES | CN(CCCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)c1ccc(C2(C#N)CC2)cc1 |
| InChI | InChI=1S/C28H29N5O4/c1-32(20-7-4-18(5-8-20)28(17-29)12-13-28)15-3-2-14-30-19-6-9-21-22(16-19)27(37)33(26(21)36)23-10-11-24(34)31-25(23)35/h4-9,16,23,30H,2-3,10-15H2,1H3,(H,31,34,35) |
| InChIKey | RMRNXYKMEVINIV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|