About (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid
(2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid (PubChem CID 155338382) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid.
Molecular Properties
| Compound Name | (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid |
| PubChem CID | 155338382 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid |
| SMILES | COc1cc2c(cn1)CC/C2=C/C(=O)O |
| InChI | InChI=1S/C11H11NO3/c1-15-10-5-9-7(4-11(13)14)2-3-8(9)6-12-10/h4-6H,2-3H2,1H3,(H,13,14)/b7-4- |
| InChIKey | JIUWGQKKDCYSFE-DAXSKMNVSA-N |
| XLogP | 1.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid?
The IUPAC name of (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid (CID 155338382) is (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid.
What is the SMILES notation for (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid?
The canonical SMILES for (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid is COc1cc2c(cn1)CC/C2=C/C(=O)O.
What is the InChIKey of (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid?
The InChIKey is JIUWGQKKDCYSFE-DAXSKMNVSA-N. The full InChI is InChI=1S/C11H11NO3/c1-15-10-5-9-7(4-11(13)14)2-3-8(9)6-12-10/h4-6H,2-3H2,1H3,(H,13,14)/b7-4-.
What are the key properties of (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid?
(2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid has a molecular weight of 205.21 g/mol, XLogP of 1.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3-methoxy-6,7-dihydrocyclopenta[c]pyridin-5-ylidene)acetic acid is sourced from PubChem (CID 155338382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).