C20H22FNO5 — CID 155342350
methyl 4-(2-fluoro-6-methoxyphenyl)-6-(oxan-2-yloxymethyl)pyridine-3-carboxylate (PubChem CID 155342350) has the molecular formula C20H22FNO5 and a molecular weight of 375.40 g/mol. Its IUPAC name is methyl 4-(2-fluoro-6-methoxyphenyl)-6-(oxan-2-yloxymethyl)pyridine-3-carboxylate.
| Compound Name | methyl 4-(2-fluoro-6-methoxyphenyl)-6-(oxan-2-yloxymethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155342350 |
| Molecular Formula | C20H22FNO5 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | methyl 4-(2-fluoro-6-methoxyphenyl)-6-(oxan-2-yloxymethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(COC2CCCCO2)cc1-c1c(F)cccc1OC |
| InChI | InChI=1S/C20H22FNO5/c1-24-17-7-5-6-16(21)19(17)14-10-13(22-11-15(14)20(23)25-2)12-27-18-8-3-4-9-26-18/h5-7,10-11,18H,3-4,8-9,12H2,1-2H3 |
| InChIKey | HTZSHPCIJNHTTQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |