C25H25ClN2O4 — CID 155343635
ethyl 6-[(4-chlorophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carboxylate (PubChem CID 155343635) has the molecular formula C25H25ClN2O4 and a molecular weight of 452.94 g/mol. Its IUPAC name is ethyl 6-[(4-chlorophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carboxylate.
| Compound Name | ethyl 6-[(4-chlorophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 155343635 |
| Molecular Formula | C25H25ClN2O4 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | ethyl 6-[(4-chlorophenyl)methoxy]-4-(piperidine-1-carbonyl)quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)N2CCCCC2)c2cc(OCc3ccc(Cl)cc3)ccc2n1 |
| InChI | InChI=1S/C25H25ClN2O4/c1-2-31-25(30)23-15-21(24(29)28-12-4-3-5-13-28)20-14-19(10-11-22(20)27-23)32-16-17-6-8-18(26)9-7-17/h6-11,14-15H,2-5,12-13,16H2,1H3 |
| InChIKey | RTPPLENDECNRAX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |