C11H14O2S — CID 155347809
2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl prop-2-enoate (PubChem CID 155347809) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl prop-2-enoate.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl prop-2-enoate |
|---|---|
| PubChem CID | 155347809 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]sulfanylethyl prop-2-enoate |
| SMILES | C=C/C=C(\C=C)SCCOC(=O)C=C |
| InChI | InChI=1S/C11H14O2S/c1-4-7-10(5-2)14-9-8-13-11(12)6-3/h4-7H,1-3,8-9H2/b10-7+ |
| InChIKey | NDPAZIINWURMJY-JXMROGBWSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|