C21H38O4Si — CID 15535399
methyl (1S,2E,4S,5R)-4-tert-butyl-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate (PubChem CID 15535399) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is methyl (1S,2E,4S,5R)-4-tert-butyl-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate.
| Compound Name | methyl (1S,2E,4S,5R)-4-tert-butyl-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 15535399 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl (1S,2E,4S,5R)-4-tert-butyl-2-[tert-butyl(dimethyl)silyl]oxy-5-formylcyclooct-2-ene-1-carboxylate |
| SMILES | COC(=O)[C@H]1CCC[C@@H](C=O)[C@@H](C(C)(C)C)/C=C\1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O4Si/c1-20(2,3)17-13-18(25-26(8,9)21(4,5)6)16(19(23)24-7)12-10-11-15(17)14-22/h13-17H,10-12H2,1-9H3/b18-13+/t15-,16-,17-/m0/s1 |
| InChIKey | SZIYBSJFPOSNPD-OXYCGWCVSA-N |
| XLogP | 5.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|