C21H34O6Si — CID 135028470
dimethyl 2-[[3-[tert-butyl(dimethyl)silyl]oxy-6-formylcyclohex-2-en-1-yl]methyl]cyclopropane-1,1-dicarboxylate (PubChem CID 135028470) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is dimethyl 2-[[3-[tert-butyl(dimethyl)silyl]oxy-6-formylcyclohex-2-en-1-yl]methyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[[3-[tert-butyl(dimethyl)silyl]oxy-6-formylcyclohex-2-en-1-yl]methyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135028470 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | dimethyl 2-[[3-[tert-butyl(dimethyl)silyl]oxy-6-formylcyclohex-2-en-1-yl]methyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1CC1C=C(O[Si](C)(C)C(C)(C)C)CCC1C=O |
| InChI | InChI=1S/C21H34O6Si/c1-20(2,3)28(6,7)27-17-9-8-14(13-22)15(11-17)10-16-12-21(16,18(23)25-4)19(24)26-5/h11,13-16H,8-10,12H2,1-7H3 |
| InChIKey | DGZLOMRGHMNTQV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|