C28H42NO8P3 — CID 155355266
N-[bis[[4-[(E)-2-dimethoxyphosphorylethenyl]phenyl]methoxy]phosphanyl]-N-propan-2-ylpropan-2-amine (PubChem CID 155355266) has the molecular formula C28H42NO8P3 and a molecular weight of 613.57 g/mol. Its IUPAC name is N-[bis[[4-[(E)-2-dimethoxyphosphorylethenyl]phenyl]methoxy]phosphanyl]-N-propan-2-ylpropan-2-amine.
| Compound Name | N-[bis[[4-[(E)-2-dimethoxyphosphorylethenyl]phenyl]methoxy]phosphanyl]-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 155355266 |
| Molecular Formula | C28H42NO8P3 |
| Molecular Weight | 613.57 g/mol |
| Exact Mass | 613.21 |
| IUPAC Name | N-[bis[[4-[(E)-2-dimethoxyphosphorylethenyl]phenyl]methoxy]phosphanyl]-N-propan-2-ylpropan-2-amine |
| SMILES | COP(=O)(/C=C/c1ccc(COP(OCc2ccc(/C=C/P(=O)(OC)OC)cc2)N(C(C)C)C(C)C)cc1)OC |
| InChI | InChI=1S/C28H42NO8P3/c1-23(2)29(24(3)4)38(36-21-27-13-9-25(10-14-27)17-19-39(30,32-5)33-6)37-22-28-15-11-26(12-16-28)18-20-40(31,34-7)35-8/h9-20,23-24H,21-22H2,1-8H3/b19-17+,20-18+ |
| InChIKey | QAIMYNIONYQSEJ-XPWSMXQVSA-N |
| XLogP | 8.68 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.57 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|