C20H28N6O10 — CID 155357533
(2S)-2-[3-[5-(5-azidopentanoylamino)-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 155357533) has the molecular formula C20H28N6O10 and a molecular weight of 512.48 g/mol. Its IUPAC name is (2S)-2-[3-[5-(5-azidopentanoylamino)-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[3-[5-(5-azidopentanoylamino)-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 155357533 |
| Molecular Formula | C20H28N6O10 |
| Molecular Weight | 512.48 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | (2S)-2-[3-[5-(5-azidopentanoylamino)-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | [N-]=[N+]=NCCCCC(=O)NCCCCC(C(=O)O)N1C(=O)CC(=O)N([C@@H](CCC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C20H28N6O10/c21-24-23-10-4-2-6-14(27)22-9-3-1-5-12(18(32)33)25-15(28)11-16(29)26(20(25)36)13(19(34)35)7-8-17(30)31/h12-13H,1-11H2,(H,22,27)(H,30,31)(H,32,33)(H,34,35)/t12?,13-/m0/s1 |
| InChIKey | JQUQTGNMZUJAGY-ABLWVSNPSA-N |
| XLogP | 0.71 |
| TPSA | 247.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.48 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|