C17H22N6O10 — CID 135170405
2-[3-[5-[(2-azidoacetyl)amino]-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 135170405) has the molecular formula C17H22N6O10 and a molecular weight of 470.40 g/mol. Its IUPAC name is 2-[3-[5-[(2-azidoacetyl)amino]-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | 2-[3-[5-[(2-azidoacetyl)amino]-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 135170405 |
| Molecular Formula | C17H22N6O10 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[3-[5-[(2-azidoacetyl)amino]-1-carboxypentyl]-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | [N-]=[N+]=NCC(=O)NCCCCC(C(=O)O)N1C(=O)CC(=O)N(C(CCC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C17H22N6O10/c18-21-20-8-11(24)19-6-2-1-3-9(15(29)30)22-12(25)7-13(26)23(17(22)33)10(16(31)32)4-5-14(27)28/h9-10H,1-8H2,(H,19,24)(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | WWLRIPXSSYHFDN-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 247.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|