C14H18N4O5 — CID 155365079
7-(1-methoxyethenoxymethoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione (PubChem CID 155365079) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is 7-(1-methoxyethenoxymethoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione.
| Compound Name | 7-(1-methoxyethenoxymethoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 155365079 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 7-(1-methoxyethenoxymethoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
| SMILES | C=C(OC)OCOc1c2n(ncc1=O)CN1CCCCN1C2=O |
| InChI | InChI=1S/C14H18N4O5/c1-10(21-2)22-9-23-13-11(19)7-15-17-8-16-5-3-4-6-18(16)14(20)12(13)17/h7H,1,3-6,8-9H2,2H3 |
| InChIKey | FXBSFGNPILFUAY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 86.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|