C15H22N4O3 — CID 166646116
7-(2-methylbutoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione (PubChem CID 166646116) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 7-(2-methylbutoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione.
| Compound Name | 7-(2-methylbutoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 166646116 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 7-(2-methylbutoxy)-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-diene-6,9-dione |
| SMILES | CCC(C)COc1c2n(ncc1=O)CN1CCCCN1C2=O |
| InChI | InChI=1S/C15H22N4O3/c1-3-11(2)9-22-14-12(20)8-16-18-10-17-6-4-5-7-19(17)15(21)13(14)18/h8,11H,3-7,9-10H2,1-2H3 |
| InChIKey | YJSONMXSYBXKML-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |