C14H18N4O6 — CID 142297252
(6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl ethyl carbonate (PubChem CID 142297252) has the molecular formula C14H18N4O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl ethyl carbonate.
| Compound Name | (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl ethyl carbonate |
|---|---|
| PubChem CID | 142297252 |
| Molecular Formula | C14H18N4O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (6,9-dioxo-1,3,4,10-tetrazatricyclo[8.4.0.03,8]tetradeca-4,7-dien-7-yl)oxymethyl ethyl carbonate |
| SMILES | CCOC(=O)OCOc1c2n(ncc1=O)CN1CCCCN1C2=O |
| InChI | InChI=1S/C14H18N4O6/c1-2-22-14(21)24-9-23-12-10(19)7-15-17-8-16-5-3-4-6-18(16)13(20)11(12)17/h7H,2-6,8-9H2,1H3 |
| InChIKey | LUXHSQYZDPVTLI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 103.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|