C15H22N4O5 — CID 134314590
(3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl N-ethyl-N-methylcarbamate (PubChem CID 134314590) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl N-ethyl-N-methylcarbamate.
| Compound Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl N-ethyl-N-methylcarbamate |
|---|---|
| PubChem CID | 134314590 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (3,5-dioxo-6-propyl-7,8-dihydropyrazino[1,2-b]pyridazin-4-yl)oxymethyl N-ethyl-N-methylcarbamate |
| SMILES | CCCN1CCn2ncc(=O)c(OCOC(=O)N(C)CC)c2C1=O |
| InChI | InChI=1S/C15H22N4O5/c1-4-6-18-7-8-19-12(14(18)21)13(11(20)9-16-19)23-10-24-15(22)17(3)5-2/h9H,4-8,10H2,1-3H3 |
| InChIKey | QJFITHZKAGHOGD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|