C19H16Cl2N2O3 — CID 155367263
4,5-dichloro-3-morpholin-3-yl-1-phenylindole-2-carboxylic acid (PubChem CID 155367263) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 4,5-dichloro-3-morpholin-3-yl-1-phenylindole-2-carboxylic acid.
| Compound Name | 4,5-dichloro-3-morpholin-3-yl-1-phenylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 155367263 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4,5-dichloro-3-morpholin-3-yl-1-phenylindole-2-carboxylic acid |
| SMILES | O=C(O)c1c(C2COCCN2)c2c(Cl)c(Cl)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C19H16Cl2N2O3/c20-12-6-7-14-16(17(12)21)15(13-10-26-9-8-22-13)18(19(24)25)23(14)11-4-2-1-3-5-11/h1-7,13,22H,8-10H2,(H,24,25) |
| InChIKey | AGINWHOIMICCHU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |