C24H32ClN3O4 — CID 155368234
11-(4-aminobutyl)-9-chloro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzo[b][1,4]benzodiazepin-6-one (PubChem CID 155368234) has the molecular formula C24H32ClN3O4 and a molecular weight of 461.99 g/mol. Its IUPAC name is 11-(4-aminobutyl)-9-chloro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 11-(4-aminobutyl)-9-chloro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 155368234 |
| Molecular Formula | C24H32ClN3O4 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 11-(4-aminobutyl)-9-chloro-5-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]benzo[b][1,4]benzodiazepin-6-one |
| SMILES | COCCOCCOCCN1C(=O)c2ccc(Cl)cc2N(CCCCN)c2ccccc21 |
| InChI | InChI=1S/C24H32ClN3O4/c1-30-14-15-32-17-16-31-13-12-28-22-7-3-2-6-21(22)27(11-5-4-10-26)23-18-19(25)8-9-20(23)24(28)29/h2-3,6-9,18H,4-5,10-17,26H2,1H3 |
| InChIKey | MPBYBTAEEIFSSZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|