C7H11F2NO3 — CID 155368585
[(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl] carbamate (PubChem CID 155368585) has the molecular formula C7H11F2NO3 and a molecular weight of 195.16 g/mol. Its IUPAC name is [(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl] carbamate.
| Compound Name | [(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl] carbamate |
|---|---|
| PubChem CID | 155368585 |
| Molecular Formula | C7H11F2NO3 |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | [(1S)-3,3-difluoro-1-(hydroxymethyl)cyclopentyl] carbamate |
| SMILES | NC(=O)O[C@@]1(CO)CCC(F)(F)C1 |
| InChI | InChI=1S/C7H11F2NO3/c8-7(9)2-1-6(3-7,4-11)13-5(10)12/h11H,1-4H2,(H2,10,12)/t6-/m0/s1 |
| InChIKey | LONASDFOWBNLPV-LURJTMIESA-N |
| XLogP | 0.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |