C46H50N2 — CID 155371748
N-cyclohexa-2,4-dien-1-yl-4-[[4-[4-[(3,6-dimethylcyclohexen-1-yl)-(6-methylcyclohexa-2,4-dien-1-yl)amino]cyclohexa-1,3-dien-1-yl]phenyl]methyl]-N-phenylaniline (PubChem CID 155371748) has the molecular formula C46H50N2 and a molecular weight of 630.92 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-yl-4-[[4-[4-[(3,6-dimethylcyclohexen-1-yl)-(6-methylcyclohexa-2,4-dien-1-yl)amino]cyclohexa-1,3-dien-1-yl]phenyl]methyl]-N-phenylaniline.
| Compound Name | N-cyclohexa-2,4-dien-1-yl-4-[[4-[4-[(3,6-dimethylcyclohexen-1-yl)-(6-methylcyclohexa-2,4-dien-1-yl)amino]cyclohexa-1,3-dien-1-yl]phenyl]methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 155371748 |
| Molecular Formula | C46H50N2 |
| Molecular Weight | 630.92 g/mol |
| Exact Mass | 630.40 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-yl-4-[[4-[4-[(3,6-dimethylcyclohexen-1-yl)-(6-methylcyclohexa-2,4-dien-1-yl)amino]cyclohexa-1,3-dien-1-yl]phenyl]methyl]-N-phenylaniline |
| SMILES | CC1C=C(N(C2=CC=C(c3ccc(Cc4ccc(N(c5ccccc5)C5C=CC=CC5)cc4)cc3)CC2)C2C=CC=CC2C)C(C)CC1 |
| InChI | InChI=1S/C46H50N2/c1-34-18-19-36(3)46(32-34)48(45-17-11-10-12-35(45)2)44-30-26-40(27-31-44)39-24-20-37(21-25-39)33-38-22-28-43(29-23-38)47(41-13-6-4-7-14-41)42-15-8-5-9-16-42/h4-15,17,20-26,28-30,32,34-36,42,45H,16,18-19,27,31,33H2,1-3H3 |
| InChIKey | OVMYQRAGBWASHL-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.92 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |