C37H45N3O8 — CID 155375944
butyl 2-[1-[[4-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methoxy]ethoxy]acetate (PubChem CID 155375944) has the molecular formula C37H45N3O8 and a molecular weight of 659.78 g/mol. Its IUPAC name is butyl 2-[1-[[4-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methoxy]ethoxy]acetate.
| Compound Name | butyl 2-[1-[[4-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 155375944 |
| Molecular Formula | C37H45N3O8 |
| Molecular Weight | 659.78 g/mol |
| Exact Mass | 659.32 |
| IUPAC Name | butyl 2-[1-[[4-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]phenyl]methoxy]ethoxy]acetate |
| SMILES | CCCCOC(=O)COC(C)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)OCC2c3ccccc3-c3ccccc32)C(C)C)cc1 |
| InChI | InChI=1S/C37H45N3O8/c1-5-6-19-45-34(42)23-47-25(4)46-21-26-15-17-27(18-16-26)39-33(41)20-38-36(43)35(24(2)3)40-37(44)48-22-32-30-13-9-7-11-28(30)29-12-8-10-14-31(29)32/h7-18,24-25,32,35H,5-6,19-23H2,1-4H3,(H,38,43)(H,39,41)(H,40,44) |
| InChIKey | BNIYSRJCRMYRSW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.78 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|