C43H46N4O11 — CID 175367797
[5-[3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoylamino]-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl] hexanoate (PubChem CID 175367797) has the molecular formula C43H46N4O11 and a molecular weight of 794.86 g/mol. Its IUPAC name is [5-[3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoylamino]-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl] hexanoate.
| Compound Name | [5-[3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoylamino]-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl] hexanoate |
|---|---|
| PubChem CID | 175367797 |
| Molecular Formula | C43H46N4O11 |
| Molecular Weight | 794.86 g/mol |
| Exact Mass | 794.32 |
| IUPAC Name | [5-[3-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]propanoylamino]-2-[(4-nitrophenoxy)carbonyloxymethyl]phenyl] hexanoate |
| SMILES | CCCCCC(=O)Oc1cc(NC(=O)CCNC(=O)[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(C)C)ccc1COC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C43H46N4O11/c1-4-5-6-15-39(49)58-37-24-29(17-16-28(37)25-56-43(52)57-31-20-18-30(19-21-31)47(53)54)45-38(48)22-23-44-41(50)40(27(2)3)46-42(51)55-26-36-34-13-9-7-11-32(34)33-12-8-10-14-35(33)36/h7-14,16-21,24,27,36,40H,4-6,15,22-23,25-26H2,1-3H3,(H,44,50)(H,45,48)(H,46,51)/t40-/m0/s1 |
| InChIKey | LIGFUPIKQLLOPL-FAIXQHPJSA-N |
| XLogP | 7.80 |
| TPSA | 201.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.86 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|