C19H18F3N3O3S — CID 155381016
N-[2-[(dimethylamino)methyl]quinolin-8-yl]-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 155381016) has the molecular formula C19H18F3N3O3S and a molecular weight of 425.43 g/mol. Its IUPAC name is N-[2-[(dimethylamino)methyl]quinolin-8-yl]-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[2-[(dimethylamino)methyl]quinolin-8-yl]-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 155381016 |
| Molecular Formula | C19H18F3N3O3S |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | N-[2-[(dimethylamino)methyl]quinolin-8-yl]-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(C)Cc1ccc2cccc(NS(=O)(=O)c3cccc(OC(F)(F)F)c3)c2n1 |
| InChI | InChI=1S/C19H18F3N3O3S/c1-25(2)12-14-10-9-13-5-3-8-17(18(13)23-14)24-29(26,27)16-7-4-6-15(11-16)28-19(20,21)22/h3-11,24H,12H2,1-2H3 |
| InChIKey | IZJZRCFMHHTNQQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |