C23H16Cl2F3N3O3S — CID 155381156
N-[2-[(3,5-dichloro-2-hydroxyanilino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 155381156) has the molecular formula C23H16Cl2F3N3O3S and a molecular weight of 542.37 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-hydroxyanilino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[(3,5-dichloro-2-hydroxyanilino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155381156 |
| Molecular Formula | C23H16Cl2F3N3O3S |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-hydroxyanilino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc2ccc(CNc3cc(Cl)cc(Cl)c3O)nc12)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16Cl2F3N3O3S/c24-15-10-18(25)22(32)20(11-15)29-12-16-7-4-13-2-1-3-19(21(13)30-16)31-35(33,34)17-8-5-14(6-9-17)23(26,27)28/h1-11,29,31-32H,12H2 |
| InChIKey | UTVOBOBJFHTCGS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|