C18H15F3N6O4S — CID 142609933
2-nitro-1-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methyl]guanidine (PubChem CID 142609933) has the molecular formula C18H15F3N6O4S and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-nitro-1-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methyl]guanidine.
| Compound Name | 2-nitro-1-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 142609933 |
| Molecular Formula | C18H15F3N6O4S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | 2-nitro-1-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methyl]guanidine |
| SMILES | N/C(=N\[N+](=O)[O-])NCc1ccc2cccc(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C18H15F3N6O4S/c19-18(20,21)12-5-8-14(9-6-12)32(30,31)26-15-3-1-2-11-4-7-13(24-16(11)15)10-23-17(22)25-27(28)29/h1-9,26H,10H2,(H3,22,23,25) |
| InChIKey | KPJOHJUEGJXGHN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 152.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|