C20H21F3N6O2S — CID 155381041
2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine (PubChem CID 155381041) has the molecular formula C20H21F3N6O2S and a molecular weight of 466.49 g/mol. Its IUPAC name is 2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine.
| Compound Name | 2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine |
|---|---|
| PubChem CID | 155381041 |
| Molecular Formula | C20H21F3N6O2S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-[2-[[8-[[4-(trifluoromethyl)phenyl]sulfonylamino]quinolin-2-yl]methylamino]ethyl]guanidine |
| SMILES | NC(N)=NCCNCc1ccc2cccc(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C20H21F3N6O2S/c21-20(22,23)14-5-8-16(9-6-14)32(30,31)29-17-3-1-2-13-4-7-15(28-18(13)17)12-26-10-11-27-19(24)25/h1-9,26,29H,10-12H2,(H4,24,25,27) |
| InChIKey | PGVNXVBPWVVKIW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|