C19H18F3N3S — CID 142609996
2-(ethylaminomethyl)-N-[4-(trifluoromethyl)phenyl]sulfanylquinolin-8-amine (PubChem CID 142609996) has the molecular formula C19H18F3N3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-(ethylaminomethyl)-N-[4-(trifluoromethyl)phenyl]sulfanylquinolin-8-amine.
| Compound Name | 2-(ethylaminomethyl)-N-[4-(trifluoromethyl)phenyl]sulfanylquinolin-8-amine |
|---|---|
| PubChem CID | 142609996 |
| Molecular Formula | C19H18F3N3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 2-(ethylaminomethyl)-N-[4-(trifluoromethyl)phenyl]sulfanylquinolin-8-amine |
| SMILES | CCNCc1ccc2cccc(NSc3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C19H18F3N3S/c1-2-23-12-15-9-6-13-4-3-5-17(18(13)24-15)25-26-16-10-7-14(8-11-16)19(20,21)22/h3-11,23,25H,2,12H2,1H3 |
| InChIKey | GKCRDMOGKWBFAZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|