C20H20F3N3O3S — CID 148662887
N-[2-[(2-methoxyethylamino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 148662887) has the molecular formula C20H20F3N3O3S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[2-[(2-methoxyethylamino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[(2-methoxyethylamino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 148662887 |
| Molecular Formula | C20H20F3N3O3S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-[2-[(2-methoxyethylamino)methyl]quinolin-8-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | COCCNCc1ccc2cccc(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C20H20F3N3O3S/c1-29-12-11-24-13-16-8-5-14-3-2-4-18(19(14)25-16)26-30(27,28)17-9-6-15(7-10-17)20(21,22)23/h2-10,24,26H,11-13H2,1H3 |
| InChIKey | NODNSJYZFGNKNI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|