C21H22F3N3O2S — CID 142610081
2-[2-hydroxyethyl-[[8-[[4-(trifluoromethyl)phenyl]sulfanylamino]quinolin-2-yl]methyl]amino]ethanol (PubChem CID 142610081) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-[[8-[[4-(trifluoromethyl)phenyl]sulfanylamino]quinolin-2-yl]methyl]amino]ethanol.
| Compound Name | 2-[2-hydroxyethyl-[[8-[[4-(trifluoromethyl)phenyl]sulfanylamino]quinolin-2-yl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 142610081 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[2-hydroxyethyl-[[8-[[4-(trifluoromethyl)phenyl]sulfanylamino]quinolin-2-yl]methyl]amino]ethanol |
| SMILES | OCCN(CCO)Cc1ccc2cccc(NSc3ccc(C(F)(F)F)cc3)c2n1 |
| InChI | InChI=1S/C21H22F3N3O2S/c22-21(23,24)16-5-8-18(9-6-16)30-26-19-3-1-2-15-4-7-17(25-20(15)19)14-27(10-12-28)11-13-29/h1-9,26,28-29H,10-14H2 |
| InChIKey | RZHMRRBMCXMXEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|