C29H32N4O2 — CID 155381411
19-[(dimethylamino)methyl]-17-oxa-4,14,22-triazahexacyclo[20.6.1.17,14.02,6.08,13.023,28]triaconta-1(29),2(6),7(30),8,10,12,23,25,27-nonaen-3-one (PubChem CID 155381411) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 19-[(dimethylamino)methyl]-17-oxa-4,14,22-triazahexacyclo[20.6.1.17,14.02,6.08,13.023,28]triaconta-1(29),2(6),7(30),8,10,12,23,25,27-nonaen-3-one.
| Compound Name | 19-[(dimethylamino)methyl]-17-oxa-4,14,22-triazahexacyclo[20.6.1.17,14.02,6.08,13.023,28]triaconta-1(29),2(6),7(30),8,10,12,23,25,27-nonaen-3-one |
|---|---|
| PubChem CID | 155381411 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 19-[(dimethylamino)methyl]-17-oxa-4,14,22-triazahexacyclo[20.6.1.17,14.02,6.08,13.023,28]triaconta-1(29),2(6),7(30),8,10,12,23,25,27-nonaen-3-one |
| SMILES | CN(C)CC1CCn2cc(c3ccccc32)C2=C(CNC2=O)c2cn(c3ccccc23)CCOC1 |
| InChI | InChI=1S/C29H32N4O2/c1-31(2)16-20-11-12-32-18-25(22-8-4-6-10-27(22)32)28-23(15-30-29(28)34)24-17-33(13-14-35-19-20)26-9-5-3-7-21(24)26/h3-10,17-18,20H,11-16,19H2,1-2H3,(H,30,34) |
| InChIKey | ZOCDILRZDUYPSR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |