C29H34N4O3 — CID 70892305
(1E,18R,23Z,25Z)-18-[(dimethylamino)methyl]-22-methyl-17-oxa-4,14,21-triazapentacyclo[19.6.1.17,14.02,6.08,13]nonacosa-1(28),2(6),7(29),8,10,12,23,25-octaene-3,5-dione (PubChem CID 70892305) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is (1E,18R,23Z,25Z)-18-[(dimethylamino)methyl]-22-methyl-17-oxa-4,14,21-triazapentacyclo[19.6.1.17,14.02,6.08,13]nonacosa-1(28),2(6),7(29),8,10,12,23,25-octaene-3,5-dione.
| Compound Name | (1E,18R,23Z,25Z)-18-[(dimethylamino)methyl]-22-methyl-17-oxa-4,14,21-triazapentacyclo[19.6.1.17,14.02,6.08,13]nonacosa-1(28),2(6),7(29),8,10,12,23,25-octaene-3,5-dione |
|---|---|
| PubChem CID | 70892305 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | (1E,18R,23Z,25Z)-18-[(dimethylamino)methyl]-22-methyl-17-oxa-4,14,21-triazapentacyclo[19.6.1.17,14.02,6.08,13]nonacosa-1(28),2(6),7(29),8,10,12,23,25-octaene-3,5-dione |
| SMILES | CC1/C=C\C=C/C/C2=C\N1CC[C@H](CN(C)C)OCCn1cc(c3ccccc31)C1=C2C(=O)NC1=O |
| InChI | InChI=1S/C29H34N4O3/c1-20-9-5-4-6-10-21-17-32(20)14-13-22(18-31(2)3)36-16-15-33-19-24(23-11-7-8-12-25(23)33)27-26(21)28(34)30-29(27)35/h4-9,11-12,17,19-20,22H,10,13-16,18H2,1-3H3,(H,30,34,35)/b6-4-,9-5-,21-17-/t20?,22-/m1/s1 |
| InChIKey | NUMUNDTZZHOWLV-PAKVPNFJSA-N |
| XLogP | 3.49 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|