C8H8F3N — CID 155383026
2,3,6-trifluoro-4-propan-2-ylpyridine (PubChem CID 155383026) has the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. Its IUPAC name is 2,3,6-trifluoro-4-propan-2-ylpyridine.
| Compound Name | 2,3,6-trifluoro-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 155383026 |
| Molecular Formula | C8H8F3N |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2,3,6-trifluoro-4-propan-2-ylpyridine |
| SMILES | CC(C)c1cc(F)nc(F)c1F |
| InChI | InChI=1S/C8H8F3N/c1-4(2)5-3-6(9)12-8(11)7(5)10/h3-4H,1-2H3 |
| InChIKey | MWKOCFAGVVOBFU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|