C11H14BrNO2S — CID 155389174
tert-butyl N-(2-bromo-5-ethenylthiophen-3-yl)carbamate (PubChem CID 155389174) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is tert-butyl N-(2-bromo-5-ethenylthiophen-3-yl)carbamate.
| Compound Name | tert-butyl N-(2-bromo-5-ethenylthiophen-3-yl)carbamate |
|---|---|
| PubChem CID | 155389174 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | tert-butyl N-(2-bromo-5-ethenylthiophen-3-yl)carbamate |
| SMILES | C=Cc1cc(NC(=O)OC(C)(C)C)c(Br)s1 |
| InChI | InChI=1S/C11H14BrNO2S/c1-5-7-6-8(9(12)16-7)13-10(14)15-11(2,3)4/h5-6H,1H2,2-4H3,(H,13,14) |
| InChIKey | XYXFUJKFSKEGJV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |