C20H35FN2 — CID 155394160
(Z)-5-N-[(E)-2-(2-ethylcyclopropyl)prop-1-enyl]-1-fluoro-2-methyl-1-N-(2-methylidenebutyl)hex-1-ene-1,5-diamine (PubChem CID 155394160) has the molecular formula C20H35FN2 and a molecular weight of 322.51 g/mol. Its IUPAC name is (Z)-5-N-[(E)-2-(2-ethylcyclopropyl)prop-1-enyl]-1-fluoro-2-methyl-1-N-(2-methylidenebutyl)hex-1-ene-1,5-diamine.
| Compound Name | (Z)-5-N-[(E)-2-(2-ethylcyclopropyl)prop-1-enyl]-1-fluoro-2-methyl-1-N-(2-methylidenebutyl)hex-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 155394160 |
| Molecular Formula | C20H35FN2 |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.28 |
| IUPAC Name | (Z)-5-N-[(E)-2-(2-ethylcyclopropyl)prop-1-enyl]-1-fluoro-2-methyl-1-N-(2-methylidenebutyl)hex-1-ene-1,5-diamine |
| SMILES | C=C(CC)CN/C(F)=C(\C)CCC(C)N/C=C(\C)C1CC1CC |
| InChI | InChI=1S/C20H35FN2/c1-7-14(3)12-23-20(21)15(4)9-10-17(6)22-13-16(5)19-11-18(19)8-2/h13,17-19,22-23H,3,7-12H2,1-2,4-6H3/b16-13+,20-15+ |
| InChIKey | OFTQNUDCMZDXDR-AULGJQFPSA-N |
| XLogP | 5.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|