C19H35N — CID 176531144
N-(2,5-dimethylhex-1-en-3-yl)-5-propylocta-1,2-dien-3-amine (PubChem CID 176531144) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is N-(2,5-dimethylhex-1-en-3-yl)-5-propylocta-1,2-dien-3-amine.
| Compound Name | N-(2,5-dimethylhex-1-en-3-yl)-5-propylocta-1,2-dien-3-amine |
|---|---|
| PubChem CID | 176531144 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | N-(2,5-dimethylhex-1-en-3-yl)-5-propylocta-1,2-dien-3-amine |
| SMILES | C=C=C(CC(CCC)CCC)NC(CC(C)C)C(=C)C |
| InChI | InChI=1S/C19H35N/c1-8-11-17(12-9-2)14-18(10-3)20-19(16(6)7)13-15(4)5/h15,17,19-20H,3,6,8-9,11-14H2,1-2,4-5,7H3 |
| InChIKey | KOWORBOCJOUAHM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|