C27H29FN2O3 — CID 155394401
2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-iminocyclopenten-1-yl)-4-methyl-2H-chromen-6-ol (PubChem CID 155394401) has the molecular formula C27H29FN2O3 and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-iminocyclopenten-1-yl)-4-methyl-2H-chromen-6-ol.
| Compound Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-iminocyclopenten-1-yl)-4-methyl-2H-chromen-6-ol |
|---|---|
| PubChem CID | 155394401 |
| Molecular Formula | C27H29FN2O3 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 2-[4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-3-(4-iminocyclopenten-1-yl)-4-methyl-2H-chromen-6-ol |
| SMILES | [H]/N=C1\CC=C(C2=C(C)c3cc(O)ccc3OC2c2ccc(OCCN3CC(CF)C3)cc2)C1 |
| InChI | InChI=1S/C27H29FN2O3/c1-17-24-13-22(31)6-9-25(24)33-27(26(17)20-2-5-21(29)12-20)19-3-7-23(8-4-19)32-11-10-30-15-18(14-28)16-30/h2-4,6-9,13,18,27,29,31H,5,10-12,14-16H2,1H3/b29-21+ |
| InChIKey | DNUAJSONGQTWIU-XHLNEMQHSA-N |
| XLogP | 5.32 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|