C42H39N3O5 — CID 15539623
2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-2-methyl-N-[3-(naphthalen-1-yldiazenyl)phenyl]propanamide (PubChem CID 15539623) has the molecular formula C42H39N3O5 and a molecular weight of 665.79 g/mol. Its IUPAC name is 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-2-methyl-N-[3-(naphthalen-1-yldiazenyl)phenyl]propanamide.
| Compound Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-2-methyl-N-[3-(naphthalen-1-yldiazenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 15539623 |
| Molecular Formula | C42H39N3O5 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | 2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-hydroxy-2-methyl-N-[3-(naphthalen-1-yldiazenyl)phenyl]propanamide |
| SMILES | COc1ccc(C(OCC(C)(CO)C(=O)Nc2cccc(/N=N/c3cccc4ccccc34)c2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C42H39N3O5/c1-41(28-46,40(47)43-34-15-10-16-35(27-34)44-45-39-18-9-12-30-11-7-8-17-38(30)39)29-50-42(31-13-5-4-6-14-31,32-19-23-36(48-2)24-20-32)33-21-25-37(49-3)26-22-33/h4-27,46H,28-29H2,1-3H3,(H,43,47)/b45-44+ |
| InChIKey | NTKPAKDNGBLBDC-JQOKOOLQSA-N |
| XLogP | 9.22 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|