C16H23N3O4S — CID 155398985
4-[[5-[(Z)-C-methyl-N-[(3-methyl-3-sulfanylbutanoyl)amino]carbonimidoyl]-2-pyridinyl]oxy]butanoic acid (PubChem CID 155398985) has the molecular formula C16H23N3O4S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[5-[(Z)-C-methyl-N-[(3-methyl-3-sulfanylbutanoyl)amino]carbonimidoyl]-2-pyridinyl]oxy]butanoic acid.
| Compound Name | 4-[[5-[(Z)-C-methyl-N-[(3-methyl-3-sulfanylbutanoyl)amino]carbonimidoyl]-2-pyridinyl]oxy]butanoic acid |
|---|---|
| PubChem CID | 155398985 |
| Molecular Formula | C16H23N3O4S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[[5-[(Z)-C-methyl-N-[(3-methyl-3-sulfanylbutanoyl)amino]carbonimidoyl]-2-pyridinyl]oxy]butanoic acid |
| SMILES | C/C(=N/NC(=O)CC(C)(C)S)c1ccc(OCCCC(=O)O)nc1 |
| InChI | InChI=1S/C16H23N3O4S/c1-11(18-19-13(20)9-16(2,3)24)12-6-7-14(17-10-12)23-8-4-5-15(21)22/h6-7,10,24H,4-5,8-9H2,1-3H3,(H,19,20)(H,21,22)/b18-11- |
| InChIKey | YUHRINSJTBYWLI-WQRHYEAKSA-N |
| XLogP | 2.26 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|