C20H23N3O4S2 — CID 76738579
4-[4-[C-methyl-N-[3-(pyridin-2-yldisulfanyl)propanoylamino]carbonimidoyl]phenoxy]butanoic acid (PubChem CID 76738579) has the molecular formula C20H23N3O4S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is 4-[4-[C-methyl-N-[3-(pyridin-2-yldisulfanyl)propanoylamino]carbonimidoyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[C-methyl-N-[3-(pyridin-2-yldisulfanyl)propanoylamino]carbonimidoyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 76738579 |
| Molecular Formula | C20H23N3O4S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-[4-[C-methyl-N-[3-(pyridin-2-yldisulfanyl)propanoylamino]carbonimidoyl]phenoxy]butanoic acid |
| SMILES | CC(=NNC(=O)CCSSc1ccccn1)c1ccc(OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C20H23N3O4S2/c1-15(16-7-9-17(10-8-16)27-13-4-6-20(25)26)22-23-18(24)11-14-28-29-19-5-2-3-12-21-19/h2-3,5,7-10,12H,4,6,11,13-14H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | OBBMHNZDAWVAJN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|