C18H25N3O4S — CID 164929747
4-[[8-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-6,7-dihydro-5H-quinolin-3-yl]oxy]butanoic acid (PubChem CID 164929747) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-[[8-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-6,7-dihydro-5H-quinolin-3-yl]oxy]butanoic acid.
| Compound Name | 4-[[8-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-6,7-dihydro-5H-quinolin-3-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 164929747 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 4-[[8-[(3-methyl-3-sulfanylbutanoyl)hydrazinylidene]-6,7-dihydro-5H-quinolin-3-yl]oxy]butanoic acid |
| SMILES | CC(C)(S)CC(=O)NN=C1CCCc2cc(OCCCC(=O)O)cnc21 |
| InChI | InChI=1S/C18H25N3O4S/c1-18(2,26)10-15(22)21-20-14-6-3-5-12-9-13(11-19-17(12)14)25-8-4-7-16(23)24/h9,11,26H,3-8,10H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | BNOXCZSKACFIGA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|