C16H24N4O4 — CID 172941357
4-[5-[(Z)-N-(3,3-dimethylbutanoylamino)-C-methylcarbonimidoyl]pyrimidin-2-yl]oxybutanoic acid (PubChem CID 172941357) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[5-[(Z)-N-(3,3-dimethylbutanoylamino)-C-methylcarbonimidoyl]pyrimidin-2-yl]oxybutanoic acid.
| Compound Name | 4-[5-[(Z)-N-(3,3-dimethylbutanoylamino)-C-methylcarbonimidoyl]pyrimidin-2-yl]oxybutanoic acid |
|---|---|
| PubChem CID | 172941357 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-[5-[(Z)-N-(3,3-dimethylbutanoylamino)-C-methylcarbonimidoyl]pyrimidin-2-yl]oxybutanoic acid |
| SMILES | C/C(=N/NC(=O)CC(C)(C)C)c1cnc(OCCCC(=O)O)nc1 |
| InChI | InChI=1S/C16H24N4O4/c1-11(19-20-13(21)8-16(2,3)4)12-9-17-15(18-10-12)24-7-5-6-14(22)23/h9-10H,5-8H2,1-4H3,(H,20,21)(H,22,23)/b19-11- |
| InChIKey | BGAFPBLNPUQVPT-ODLFYWEKSA-N |
| XLogP | 2.00 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|