C12H11F5N2 — CID 155405337
1-(3,3-difluorocyclobutyl)-3-phenyl-3-(trifluoromethyl)diaziridine (PubChem CID 155405337) has the molecular formula C12H11F5N2 and a molecular weight of 278.22 g/mol. Its IUPAC name is 1-(3,3-difluorocyclobutyl)-3-phenyl-3-(trifluoromethyl)diaziridine.
| Compound Name | 1-(3,3-difluorocyclobutyl)-3-phenyl-3-(trifluoromethyl)diaziridine |
|---|---|
| PubChem CID | 155405337 |
| Molecular Formula | C12H11F5N2 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 1-(3,3-difluorocyclobutyl)-3-phenyl-3-(trifluoromethyl)diaziridine |
| SMILES | FC1(F)CC(N2NC2(c2ccccc2)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H11F5N2/c13-10(14)6-9(7-10)19-11(18-19,12(15,16)17)8-4-2-1-3-5-8/h1-5,9,18H,6-7H2 |
| InChIKey | XRSPECXJWTXXAY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|