C16H13ClN2O4S — CID 15541218
4-chloro-N-ethyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzenesulfonamide (PubChem CID 15541218) has the molecular formula C16H13ClN2O4S and a molecular weight of 364.81 g/mol. Its IUPAC name is 4-chloro-N-ethyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-ethyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 15541218 |
| Molecular Formula | C16H13ClN2O4S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 4-chloro-N-ethyl-N-(4-oxo-3,1-benzoxazin-2-yl)benzenesulfonamide |
| SMILES | CCN(c1nc2ccccc2c(=O)o1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClN2O4S/c1-2-19(24(21,22)12-9-7-11(17)8-10-12)16-18-14-6-4-3-5-13(14)15(20)23-16/h3-10H,2H2,1H3 |
| InChIKey | VOCVGPVNQLFNDS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |