C17H15ClN2O5S — CID 69233539
5-[(5-chloro-1,3-benzoxazol-2-yl)-ethylsulfamoyl]-2-methylbenzoic acid (PubChem CID 69233539) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is 5-[(5-chloro-1,3-benzoxazol-2-yl)-ethylsulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[(5-chloro-1,3-benzoxazol-2-yl)-ethylsulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 69233539 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | 5-[(5-chloro-1,3-benzoxazol-2-yl)-ethylsulfamoyl]-2-methylbenzoic acid |
| SMILES | CCN(c1nc2cc(Cl)ccc2o1)S(=O)(=O)c1ccc(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H15ClN2O5S/c1-3-20(17-19-14-8-11(18)5-7-15(14)25-17)26(23,24)12-6-4-10(2)13(9-12)16(21)22/h4-9H,3H2,1-2H3,(H,21,22) |
| InChIKey | UBQBESSSYLPCKM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |