C26H24ClN3O6S2 — CID 165027705
[(4-chlorophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate (PubChem CID 165027705) has the molecular formula C26H24ClN3O6S2 and a molecular weight of 574.08 g/mol. Its IUPAC name is [(4-chlorophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate.
| Compound Name | [(4-chlorophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate |
|---|---|
| PubChem CID | 165027705 |
| Molecular Formula | C26H24ClN3O6S2 |
| Molecular Weight | 574.08 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | [(4-chlorophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(Cl)cc2)c2ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H24ClN3O6S2/c1-3-29(37(32,33)21-12-8-19(2)9-13-21)25-16-28-26(24-7-5-4-6-23(24)25)30(17-36-18-31)38(34,35)22-14-10-20(27)11-15-22/h4-16,18H,3,17H2,1-2H3 |
| InChIKey | JTSGVKPNXHYQKW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 113.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.08 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|