C27H24N4O6S2 — CID 165013473
[(4-cyanophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate (PubChem CID 165013473) has the molecular formula C27H24N4O6S2 and a molecular weight of 564.65 g/mol. Its IUPAC name is [(4-cyanophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate.
| Compound Name | [(4-cyanophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate |
|---|---|
| PubChem CID | 165013473 |
| Molecular Formula | C27H24N4O6S2 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | [(4-cyanophenyl)sulfonyl-[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]amino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(C#N)cc2)c2ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H24N4O6S2/c1-3-30(38(33,34)22-12-8-20(2)9-13-22)26-17-29-27(25-7-5-4-6-24(25)26)31(18-37-19-32)39(35,36)23-14-10-21(16-28)11-15-23/h4-15,17,19H,3,18H2,1-2H3 |
| InChIKey | VAVNTENANAAUSH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 137.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|