C27H21F3N4O7S2 — CID 158392305
[[4-[(4-cyanophenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-[4-(trifluoromethoxy)phenyl]sulfonylamino]methyl formate (PubChem CID 158392305) has the molecular formula C27H21F3N4O7S2 and a molecular weight of 634.61 g/mol. Its IUPAC name is [[4-[(4-cyanophenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-[4-(trifluoromethoxy)phenyl]sulfonylamino]methyl formate.
| Compound Name | [[4-[(4-cyanophenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-[4-(trifluoromethoxy)phenyl]sulfonylamino]methyl formate |
|---|---|
| PubChem CID | 158392305 |
| Molecular Formula | C27H21F3N4O7S2 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | [[4-[(4-cyanophenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-[4-(trifluoromethoxy)phenyl]sulfonylamino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(OC(F)(F)F)cc2)c2ccccc12)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H21F3N4O7S2/c1-2-33(42(36,37)21-11-7-19(15-31)8-12-21)25-16-32-26(24-6-4-3-5-23(24)25)34(17-40-18-35)43(38,39)22-13-9-20(10-14-22)41-27(28,29)30/h3-14,16,18H,2,17H2,1H3 |
| InChIKey | GXCOCWFKGDLHBN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 146.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|