C27H27N3O7S2 — CID 159862178
[[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]-(4-methoxyphenyl)sulfonylamino]methyl formate (PubChem CID 159862178) has the molecular formula C27H27N3O7S2 and a molecular weight of 569.66 g/mol. Its IUPAC name is [[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]-(4-methoxyphenyl)sulfonylamino]methyl formate.
| Compound Name | [[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]-(4-methoxyphenyl)sulfonylamino]methyl formate |
|---|---|
| PubChem CID | 159862178 |
| Molecular Formula | C27H27N3O7S2 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | [[4-[ethyl-(4-methylphenyl)sulfonylamino]isoquinolin-1-yl]-(4-methoxyphenyl)sulfonylamino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(OC)cc2)c2ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H27N3O7S2/c1-4-29(38(32,33)22-13-9-20(2)10-14-22)26-17-28-27(25-8-6-5-7-24(25)26)30(18-37-19-31)39(34,35)23-15-11-21(36-3)12-16-23/h5-17,19H,4,18H2,1-3H3 |
| InChIKey | NRHDCCNRXKPZKL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 123.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|