C28H24N4O7S2 — CID 165013474
[[4-[(4-acetylphenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-(4-cyanophenyl)sulfonylamino]methyl formate (PubChem CID 165013474) has the molecular formula C28H24N4O7S2 and a molecular weight of 592.66 g/mol. Its IUPAC name is [[4-[(4-acetylphenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-(4-cyanophenyl)sulfonylamino]methyl formate.
| Compound Name | [[4-[(4-acetylphenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-(4-cyanophenyl)sulfonylamino]methyl formate |
|---|---|
| PubChem CID | 165013474 |
| Molecular Formula | C28H24N4O7S2 |
| Molecular Weight | 592.66 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | [[4-[(4-acetylphenyl)sulfonyl-ethylamino]isoquinolin-1-yl]-(4-cyanophenyl)sulfonylamino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(C#N)cc2)c2ccccc12)S(=O)(=O)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C28H24N4O7S2/c1-3-31(40(35,36)24-14-10-22(11-15-24)20(2)34)27-17-30-28(26-7-5-4-6-25(26)27)32(18-39-19-33)41(37,38)23-12-8-21(16-29)9-13-23/h4-15,17,19H,3,18H2,1-2H3 |
| InChIKey | DRNGINRBVYYVBD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 154.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|