C27H21F4N3O7S2 — CID 160845218
[[4-[ethyl-[4-(2,2,2-trifluoroacetyl)phenyl]sulfonylamino]isoquinolin-1-yl]-(4-fluorophenyl)sulfonylamino]methyl formate (PubChem CID 160845218) has the molecular formula C27H21F4N3O7S2 and a molecular weight of 639.61 g/mol. Its IUPAC name is [[4-[ethyl-[4-(2,2,2-trifluoroacetyl)phenyl]sulfonylamino]isoquinolin-1-yl]-(4-fluorophenyl)sulfonylamino]methyl formate.
| Compound Name | [[4-[ethyl-[4-(2,2,2-trifluoroacetyl)phenyl]sulfonylamino]isoquinolin-1-yl]-(4-fluorophenyl)sulfonylamino]methyl formate |
|---|---|
| PubChem CID | 160845218 |
| Molecular Formula | C27H21F4N3O7S2 |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | [[4-[ethyl-[4-(2,2,2-trifluoroacetyl)phenyl]sulfonylamino]isoquinolin-1-yl]-(4-fluorophenyl)sulfonylamino]methyl formate |
| SMILES | CCN(c1cnc(N(COC=O)S(=O)(=O)c2ccc(F)cc2)c2ccccc12)S(=O)(=O)c1ccc(C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H21F4N3O7S2/c1-2-33(42(37,38)20-11-7-18(8-12-20)25(36)27(29,30)31)24-15-32-26(23-6-4-3-5-22(23)24)34(16-41-17-35)43(39,40)21-13-9-19(28)10-14-21/h3-15,17H,2,16H2,1H3 |
| InChIKey | SIOAUVHCDHILFI-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 131.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|