C19H27ClN2O5 — CID 155413510
tert-butyl 3-[[[(2S)-2-(4-chlorophenoxy)propanoyl]amino]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 155413510) has the molecular formula C19H27ClN2O5 and a molecular weight of 398.89 g/mol. Its IUPAC name is tert-butyl 3-[[[(2S)-2-(4-chlorophenoxy)propanoyl]amino]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[(2S)-2-(4-chlorophenoxy)propanoyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155413510 |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | tert-butyl 3-[[[(2S)-2-(4-chlorophenoxy)propanoyl]amino]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)NOCC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H27ClN2O5/c1-13(26-16-7-5-15(20)6-8-16)17(23)21-25-12-14-9-10-22(11-14)18(24)27-19(2,3)4/h5-8,13-14H,9-12H2,1-4H3,(H,21,23)/t13-,14?/m0/s1 |
| InChIKey | VPFUZRICSGHEFP-LSLKUGRBSA-N |
| XLogP | 3.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|