C22H22O5 — CID 155420721
[2-[(3E,6E)-7-methoxyocta-1,3,6-trien-3-yl]-4-oxochromen-6-yl] 2-methylprop-2-enoate (PubChem CID 155420721) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is [2-[(3E,6E)-7-methoxyocta-1,3,6-trien-3-yl]-4-oxochromen-6-yl] 2-methylprop-2-enoate.
| Compound Name | [2-[(3E,6E)-7-methoxyocta-1,3,6-trien-3-yl]-4-oxochromen-6-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155420721 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [2-[(3E,6E)-7-methoxyocta-1,3,6-trien-3-yl]-4-oxochromen-6-yl] 2-methylprop-2-enoate |
| SMILES | C=C/C(=C\C/C=C(\C)OC)c1cc(=O)c2cc(OC(=O)C(=C)C)ccc2o1 |
| InChI | InChI=1S/C22H22O5/c1-6-16(9-7-8-15(4)25-5)21-13-19(23)18-12-17(10-11-20(18)27-21)26-22(24)14(2)3/h6,8-13H,1-2,7H2,3-5H3/b15-8+,16-9+ |
| InChIKey | JBHPUYOTBNNYSS-BVXMOGEKSA-N |
| XLogP | 4.78 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|